C17H20F3N3O2 — CID 84582681
1-[4-[1-[4-(trifluoromethyl)benzoyl]azetidin-3-yl]piperazin-1-yl]ethanone (PubChem CID 84582681) has the molecular formula C17H20F3N3O2 and a molecular weight of 355.36 g/mol. Its IUPAC name is 1-[4-[1-[4-(trifluoromethyl)benzoyl]azetidin-3-yl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[1-[4-(trifluoromethyl)benzoyl]azetidin-3-yl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 84582681 |
| Molecular Formula | C17H20F3N3O2 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 1-[4-[1-[4-(trifluoromethyl)benzoyl]azetidin-3-yl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(C2CN(C(=O)c3ccc(C(F)(F)F)cc3)C2)CC1 |
| InChI | InChI=1S/C17H20F3N3O2/c1-12(24)21-6-8-22(9-7-21)15-10-23(11-15)16(25)13-2-4-14(5-3-13)17(18,19)20/h2-5,15H,6-11H2,1H3 |
| InChIKey | UAJOMCLHUMNRHZ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |