C16H21ClF3N3O — CID 120995892
(3-piperazin-1-ylpyrrolidin-1-yl)-[4-(trifluoromethyl)phenyl]methanone;hydrochloride (PubChem CID 120995892) has the molecular formula C16H21ClF3N3O and a molecular weight of 363.81 g/mol. Its IUPAC name is (3-piperazin-1-ylpyrrolidin-1-yl)-[4-(trifluoromethyl)phenyl]methanone;hydrochloride.
| Compound Name | (3-piperazin-1-ylpyrrolidin-1-yl)-[4-(trifluoromethyl)phenyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 120995892 |
| Molecular Formula | C16H21ClF3N3O |
| Molecular Weight | 363.81 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | (3-piperazin-1-ylpyrrolidin-1-yl)-[4-(trifluoromethyl)phenyl]methanone;hydrochloride |
| SMILES | Cl.O=C(c1ccc(C(F)(F)F)cc1)N1CCC(N2CCNCC2)C1 |
| InChI | InChI=1S/C16H20F3N3O.ClH/c17-16(18,19)13-3-1-12(2-4-13)15(23)22-8-5-14(11-22)21-9-6-20-7-10-21;/h1-4,14,20H,5-11H2;1H |
| InChIKey | IFHADLUVBQXPHA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.81 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |