C19H25ClF3N3O2 — CID 120996706
(3-piperazin-1-ylpyrrolidin-1-yl)-[2-prop-2-enoxy-5-(trifluoromethyl)phenyl]methanone;hydrochloride (PubChem CID 120996706) has the molecular formula C19H25ClF3N3O2 and a molecular weight of 419.88 g/mol. Its IUPAC name is (3-piperazin-1-ylpyrrolidin-1-yl)-[2-prop-2-enoxy-5-(trifluoromethyl)phenyl]methanone;hydrochloride.
| Compound Name | (3-piperazin-1-ylpyrrolidin-1-yl)-[2-prop-2-enoxy-5-(trifluoromethyl)phenyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 120996706 |
| Molecular Formula | C19H25ClF3N3O2 |
| Molecular Weight | 419.88 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | (3-piperazin-1-ylpyrrolidin-1-yl)-[2-prop-2-enoxy-5-(trifluoromethyl)phenyl]methanone;hydrochloride |
| SMILES | C=CCOc1ccc(C(F)(F)F)cc1C(=O)N1CCC(N2CCNCC2)C1.Cl |
| InChI | InChI=1S/C19H24F3N3O2.ClH/c1-2-11-27-17-4-3-14(19(20,21)22)12-16(17)18(26)25-8-5-15(13-25)24-9-6-23-7-10-24;/h2-4,12,15,23H,1,5-11,13H2;1H |
| InChIKey | QDYFZNQVFGDJMV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.88 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|