C18H23F3N2O2 — CID 119396320
[3-(methylaminomethyl)piperidin-1-yl]-[2-prop-2-enoxy-5-(trifluoromethyl)phenyl]methanone (PubChem CID 119396320) has the molecular formula C18H23F3N2O2 and a molecular weight of 356.39 g/mol. Its IUPAC name is [3-(methylaminomethyl)piperidin-1-yl]-[2-prop-2-enoxy-5-(trifluoromethyl)phenyl]methanone.
| Compound Name | [3-(methylaminomethyl)piperidin-1-yl]-[2-prop-2-enoxy-5-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 119396320 |
| Molecular Formula | C18H23F3N2O2 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | [3-(methylaminomethyl)piperidin-1-yl]-[2-prop-2-enoxy-5-(trifluoromethyl)phenyl]methanone |
| SMILES | C=CCOc1ccc(C(F)(F)F)cc1C(=O)N1CCCC(CNC)C1 |
| InChI | InChI=1S/C18H23F3N2O2/c1-3-9-25-16-7-6-14(18(19,20)21)10-15(16)17(24)23-8-4-5-13(12-23)11-22-2/h3,6-7,10,13,22H,1,4-5,8-9,11-12H2,2H3 |
| InChIKey | KELANRVXQIMBBU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|