C18H23F3N2O — CID 126795108
1-[3-(methylaminomethyl)piperidin-1-yl]-3-[4-(trifluoromethyl)phenyl]but-2-en-1-one (PubChem CID 126795108) has the molecular formula C18H23F3N2O and a molecular weight of 340.39 g/mol. Its IUPAC name is 1-[3-(methylaminomethyl)piperidin-1-yl]-3-[4-(trifluoromethyl)phenyl]but-2-en-1-one.
| Compound Name | 1-[3-(methylaminomethyl)piperidin-1-yl]-3-[4-(trifluoromethyl)phenyl]but-2-en-1-one |
|---|---|
| PubChem CID | 126795108 |
| Molecular Formula | C18H23F3N2O |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 1-[3-(methylaminomethyl)piperidin-1-yl]-3-[4-(trifluoromethyl)phenyl]but-2-en-1-one |
| SMILES | CNCC1CCCN(C(=O)C=C(C)c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C18H23F3N2O/c1-13(15-5-7-16(8-6-15)18(19,20)21)10-17(24)23-9-3-4-14(12-23)11-22-2/h5-8,10,14,22H,3-4,9,11-12H2,1-2H3 |
| InChIKey | HZVSJVGSPOFGMP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|