C16H17ClF3NO3 — CID 126767347
1-[3-[4-(trifluoromethyl)phenyl]but-2-enoyl]pyrrolidine-3-carboxylic acid;hydrochloride (PubChem CID 126767347) has the molecular formula C16H17ClF3NO3 and a molecular weight of 363.76 g/mol. Its IUPAC name is 1-[3-[4-(trifluoromethyl)phenyl]but-2-enoyl]pyrrolidine-3-carboxylic acid;hydrochloride.
| Compound Name | 1-[3-[4-(trifluoromethyl)phenyl]but-2-enoyl]pyrrolidine-3-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 126767347 |
| Molecular Formula | C16H17ClF3NO3 |
| Molecular Weight | 363.76 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 1-[3-[4-(trifluoromethyl)phenyl]but-2-enoyl]pyrrolidine-3-carboxylic acid;hydrochloride |
| SMILES | CC(=CC(=O)N1CCC(C(=O)O)C1)c1ccc(C(F)(F)F)cc1.Cl |
| InChI | InChI=1S/C16H16F3NO3.ClH/c1-10(11-2-4-13(5-3-11)16(17,18)19)8-14(21)20-7-6-12(9-20)15(22)23;/h2-5,8,12H,6-7,9H2,1H3,(H,22,23);1H |
| InChIKey | LVZGFLSPJGEVKD-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.76 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|