1-(3,3-dicyclopropylprop-2-enoyl)pyrrolidine-3-carboxylic acid

C14H19NO3 — CID 126782847

IUPAC1-(3,3-dicyclopropylprop-2-enoyl)pyrrolidine-3-carboxylic acid
SMILESO=C(O)C1CCN(C(=O)C=C(C2CC2)C2CC2)C1
InChIInChI=1S/C14H19NO3/c16-13(15-6-5-11(8-15)14(17)18)7-12(9-1-2-9)10-3-4-10/h7,9-11H,1-6,8H2,(H,17,18)
InChIKeyLAXCKBIDZNACDF-UHFFFAOYSA-N
MW249.31 g/mol
LogP1.67
Rot. Bonds4

About 1-(3,3-dicyclopropylprop-2-enoyl)pyrrolidine-3-carboxylic acid

1-(3,3-dicyclopropylprop-2-enoyl)pyrrolidine-3-carboxylic acid (PubChem CID 126782847) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is 1-(3,3-dicyclopropylprop-2-enoyl)pyrrolidine-3-carboxylic acid.

Molecular Properties

Compound Name1-(3,3-dicyclopropylprop-2-enoyl)pyrrolidine-3-carboxylic acid
PubChem CID126782847
Molecular FormulaC14H19NO3
Molecular Weight249.31 g/mol
Exact Mass249.14
IUPAC Name1-(3,3-dicyclopropylprop-2-enoyl)pyrrolidine-3-carboxylic acid
SMILESO=C(O)C1CCN(C(=O)C=C(C2CC2)C2CC2)C1
InChIInChI=1S/C14H19NO3/c16-13(15-6-5-11(8-15)14(17)18)7-12(9-1-2-9)10-3-4-10/h7,9-11H,1-6,8H2,(H,17,18)
InChIKeyLAXCKBIDZNACDF-UHFFFAOYSA-N
XLogP1.67
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.31
LogP ≤ 51.67
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 1-(3,3-dicyclopropylprop-2-enoyl)pyrrolidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(3,3-dicyclopropylprop-2-enoyl)pyrrolidine-3-carboxylic acid?
The IUPAC name of 1-(3,3-dicyclopropylprop-2-enoyl)pyrrolidine-3-carboxylic acid (CID 126782847) is 1-(3,3-dicyclopropylprop-2-enoyl)pyrrolidine-3-carboxylic acid.
What is the SMILES notation for 1-(3,3-dicyclopropylprop-2-enoyl)pyrrolidine-3-carboxylic acid?
The canonical SMILES for 1-(3,3-dicyclopropylprop-2-enoyl)pyrrolidine-3-carboxylic acid is O=C(O)C1CCN(C(=O)C=C(C2CC2)C2CC2)C1.
What is the InChIKey of 1-(3,3-dicyclopropylprop-2-enoyl)pyrrolidine-3-carboxylic acid?
The InChIKey is LAXCKBIDZNACDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO3/c16-13(15-6-5-11(8-15)14(17)18)7-12(9-1-2-9)10-3-4-10/h7,9-11H,1-6,8H2,(H,17,18).
What are the key properties of 1-(3,3-dicyclopropylprop-2-enoyl)pyrrolidine-3-carboxylic acid?
1-(3,3-dicyclopropylprop-2-enoyl)pyrrolidine-3-carboxylic acid has a molecular weight of 249.31 g/mol, XLogP of 1.67, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-dicyclopropylprop-2-enoyl)pyrrolidine-3-carboxylic acid is sourced from PubChem (CID 126782847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).