C14H19NO3 — CID 126782847
1-(3,3-dicyclopropylprop-2-enoyl)pyrrolidine-3-carboxylic acid (PubChem CID 126782847) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is 1-(3,3-dicyclopropylprop-2-enoyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 1-(3,3-dicyclopropylprop-2-enoyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 126782847 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 1-(3,3-dicyclopropylprop-2-enoyl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(=O)C=C(C2CC2)C2CC2)C1 |
| InChI | InChI=1S/C14H19NO3/c16-13(15-6-5-11(8-15)14(17)18)7-12(9-1-2-9)10-3-4-10/h7,9-11H,1-6,8H2,(H,17,18) |
| InChIKey | LAXCKBIDZNACDF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|