C15H21ClN2O2 — CID 119381620
(3-aminopiperidin-1-yl)-(2-prop-2-enoxyphenyl)methanone;hydrochloride (PubChem CID 119381620) has the molecular formula C15H21ClN2O2 and a molecular weight of 296.80 g/mol. Its IUPAC name is (3-aminopiperidin-1-yl)-(2-prop-2-enoxyphenyl)methanone;hydrochloride.
| Compound Name | (3-aminopiperidin-1-yl)-(2-prop-2-enoxyphenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119381620 |
| Molecular Formula | C15H21ClN2O2 |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | (3-aminopiperidin-1-yl)-(2-prop-2-enoxyphenyl)methanone;hydrochloride |
| SMILES | C=CCOc1ccccc1C(=O)N1CCCC(N)C1.Cl |
| InChI | InChI=1S/C15H20N2O2.ClH/c1-2-10-19-14-8-4-3-7-13(14)15(18)17-9-5-6-12(16)11-17;/h2-4,7-8,12H,1,5-6,9-11,16H2;1H |
| InChIKey | RIVHGNPXFSXMDC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|