C18H20BrClN2O2 — CID 119380458
(3-aminopiperidin-1-yl)-[2-(3-bromophenoxy)phenyl]methanone;hydrochloride (PubChem CID 119380458) has the molecular formula C18H20BrClN2O2 and a molecular weight of 411.73 g/mol. Its IUPAC name is (3-aminopiperidin-1-yl)-[2-(3-bromophenoxy)phenyl]methanone;hydrochloride.
| Compound Name | (3-aminopiperidin-1-yl)-[2-(3-bromophenoxy)phenyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119380458 |
| Molecular Formula | C18H20BrClN2O2 |
| Molecular Weight | 411.73 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | (3-aminopiperidin-1-yl)-[2-(3-bromophenoxy)phenyl]methanone;hydrochloride |
| SMILES | Cl.NC1CCCN(C(=O)c2ccccc2Oc2cccc(Br)c2)C1 |
| InChI | InChI=1S/C18H19BrN2O2.ClH/c19-13-5-3-7-15(11-13)23-17-9-2-1-8-16(17)18(22)21-10-4-6-14(20)12-21;/h1-3,5,7-9,11,14H,4,6,10,12,20H2;1H |
| InChIKey | LZIKTWLIUNCIJD-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.73 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |