C16H20ClN3O2 — CID 84579152
1-[4-[1-(3-chlorobenzoyl)azetidin-3-yl]piperazin-1-yl]ethanone (PubChem CID 84579152) has the molecular formula C16H20ClN3O2 and a molecular weight of 321.81 g/mol. Its IUPAC name is 1-[4-[1-(3-chlorobenzoyl)azetidin-3-yl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[1-(3-chlorobenzoyl)azetidin-3-yl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 84579152 |
| Molecular Formula | C16H20ClN3O2 |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 1-[4-[1-(3-chlorobenzoyl)azetidin-3-yl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(C2CN(C(=O)c3cccc(Cl)c3)C2)CC1 |
| InChI | InChI=1S/C16H20ClN3O2/c1-12(21)18-5-7-19(8-6-18)15-10-20(11-15)16(22)13-3-2-4-14(17)9-13/h2-4,9,15H,5-8,10-11H2,1H3 |
| InChIKey | RFQUTQTTZTVMJQ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |