C19H26ClN3O5 — CID 17369257
(3-chlorophenyl)-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]methanone;oxalic acid (PubChem CID 17369257) has the molecular formula C19H26ClN3O5 and a molecular weight of 411.89 g/mol. Its IUPAC name is (3-chlorophenyl)-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]methanone;oxalic acid.
| Compound Name | (3-chlorophenyl)-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]methanone;oxalic acid |
|---|---|
| PubChem CID | 17369257 |
| Molecular Formula | C19H26ClN3O5 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | (3-chlorophenyl)-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]methanone;oxalic acid |
| SMILES | CN1CCN(C2CCN(C(=O)c3cccc(Cl)c3)CC2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H24ClN3O.C2H2O4/c1-19-9-11-20(12-10-19)16-5-7-21(8-6-16)17(22)14-3-2-4-15(18)13-14;3-1(4)2(5)6/h2-4,13,16H,5-12H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | YEHXSIQITZQSKO-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|