C14H18ClNO2 — CID 110869857
(3-chlorophenyl)-[4-(methoxymethyl)piperidin-1-yl]methanone (PubChem CID 110869857) has the molecular formula C14H18ClNO2 and a molecular weight of 267.76 g/mol. Its IUPAC name is (3-chlorophenyl)-[4-(methoxymethyl)piperidin-1-yl]methanone.
| Compound Name | (3-chlorophenyl)-[4-(methoxymethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 110869857 |
| Molecular Formula | C14H18ClNO2 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | (3-chlorophenyl)-[4-(methoxymethyl)piperidin-1-yl]methanone |
| SMILES | COCC1CCN(C(=O)c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C14H18ClNO2/c1-18-10-11-5-7-16(8-6-11)14(17)12-3-2-4-13(15)9-12/h2-4,9,11H,5-8,10H2,1H3 |
| InChIKey | LNUGXBDMDHSWCZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |