C16H21ClN2O — CID 7026509
(3-chlorophenyl)-(4-pyrrolidin-1-ylpiperidin-1-yl)methanone (PubChem CID 7026509) has the molecular formula C16H21ClN2O and a molecular weight of 292.81 g/mol. Its IUPAC name is (3-chlorophenyl)-(4-pyrrolidin-1-ylpiperidin-1-yl)methanone.
| Compound Name | (3-chlorophenyl)-(4-pyrrolidin-1-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 7026509 |
| Molecular Formula | C16H21ClN2O |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | (3-chlorophenyl)-(4-pyrrolidin-1-ylpiperidin-1-yl)methanone |
| SMILES | O=C(c1cccc(Cl)c1)N1CCC(N2CCCC2)CC1 |
| InChI | InChI=1S/C16H21ClN2O/c17-14-5-3-4-13(12-14)16(20)19-10-6-15(7-11-19)18-8-1-2-9-18/h3-5,12,15H,1-2,6-11H2 |
| InChIKey | FLXPPUGKFOUSPC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |