C22H26F3N3O3 — CID 46413405
1-cyclopentyl-4-[4-[4-(trifluoromethyl)benzoyl]piperazine-1-carbonyl]pyrrolidin-2-one (PubChem CID 46413405) has the molecular formula C22H26F3N3O3 and a molecular weight of 437.46 g/mol. Its IUPAC name is 1-cyclopentyl-4-[4-[4-(trifluoromethyl)benzoyl]piperazine-1-carbonyl]pyrrolidin-2-one.
| Compound Name | 1-cyclopentyl-4-[4-[4-(trifluoromethyl)benzoyl]piperazine-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 46413405 |
| Molecular Formula | C22H26F3N3O3 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 1-cyclopentyl-4-[4-[4-(trifluoromethyl)benzoyl]piperazine-1-carbonyl]pyrrolidin-2-one |
| SMILES | O=C(c1ccc(C(F)(F)F)cc1)N1CCN(C(=O)C2CC(=O)N(C3CCCC3)C2)CC1 |
| InChI | InChI=1S/C22H26F3N3O3/c23-22(24,25)17-7-5-15(6-8-17)20(30)26-9-11-27(12-10-26)21(31)16-13-19(29)28(14-16)18-3-1-2-4-18/h5-8,16,18H,1-4,9-14H2 |
| InChIKey | YJJUSUFWLGJMIN-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |