C21H26F3N3O3 — CID 108535476
1-tert-butyl-4-[4-[4-(trifluoromethyl)benzoyl]piperazine-1-carbonyl]pyrrolidin-2-one (PubChem CID 108535476) has the molecular formula C21H26F3N3O3 and a molecular weight of 425.45 g/mol. Its IUPAC name is 1-tert-butyl-4-[4-[4-(trifluoromethyl)benzoyl]piperazine-1-carbonyl]pyrrolidin-2-one.
| Compound Name | 1-tert-butyl-4-[4-[4-(trifluoromethyl)benzoyl]piperazine-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 108535476 |
| Molecular Formula | C21H26F3N3O3 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 1-tert-butyl-4-[4-[4-(trifluoromethyl)benzoyl]piperazine-1-carbonyl]pyrrolidin-2-one |
| SMILES | CC(C)(C)N1CC(C(=O)N2CCN(C(=O)c3ccc(C(F)(F)F)cc3)CC2)CC1=O |
| InChI | InChI=1S/C21H26F3N3O3/c1-20(2,3)27-13-15(12-17(27)28)19(30)26-10-8-25(9-11-26)18(29)14-4-6-16(7-5-14)21(22,23)24/h4-7,15H,8-13H2,1-3H3 |
| InChIKey | SFNNGIVFLHGWOU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |