C23H25F3N2O6S — CID 118179839
N-hydroxy-3-[3-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonyl-8-azaspiro[4.5]decane-3-carboxamide (PubChem CID 118179839) has the molecular formula C23H25F3N2O6S and a molecular weight of 514.52 g/mol. Its IUPAC name is N-hydroxy-3-[3-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonyl-8-azaspiro[4.5]decane-3-carboxamide.
| Compound Name | N-hydroxy-3-[3-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonyl-8-azaspiro[4.5]decane-3-carboxamide |
|---|---|
| PubChem CID | 118179839 |
| Molecular Formula | C23H25F3N2O6S |
| Molecular Weight | 514.52 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | N-hydroxy-3-[3-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonyl-8-azaspiro[4.5]decane-3-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)c2cccc(Oc3ccc(OC(F)(F)F)cc3)c2)CCC2(CCNCC2)C1 |
| InChI | InChI=1S/C23H25F3N2O6S/c24-23(25,26)34-17-6-4-16(5-7-17)33-18-2-1-3-19(14-18)35(31,32)22(20(29)28-30)9-8-21(15-22)10-12-27-13-11-21/h1-7,14,27,30H,8-13,15H2,(H,28,29) |
| InChIKey | JACRQYGPRRDHPH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.52 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|