C24H25F3N2O6S — CID 123158468
[3-[(3-carbamoyl-8-azaspiro[4.5]decan-3-yl)sulfonyl]phenyl] 4-(trifluoromethoxy)benzoate (PubChem CID 123158468) has the molecular formula C24H25F3N2O6S and a molecular weight of 526.53 g/mol. Its IUPAC name is [3-[(3-carbamoyl-8-azaspiro[4.5]decan-3-yl)sulfonyl]phenyl] 4-(trifluoromethoxy)benzoate.
| Compound Name | [3-[(3-carbamoyl-8-azaspiro[4.5]decan-3-yl)sulfonyl]phenyl] 4-(trifluoromethoxy)benzoate |
|---|---|
| PubChem CID | 123158468 |
| Molecular Formula | C24H25F3N2O6S |
| Molecular Weight | 526.53 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | [3-[(3-carbamoyl-8-azaspiro[4.5]decan-3-yl)sulfonyl]phenyl] 4-(trifluoromethoxy)benzoate |
| SMILES | NC(=O)C1(S(=O)(=O)c2cccc(OC(=O)c3ccc(OC(F)(F)F)cc3)c2)CCC2(CCNCC2)C1 |
| InChI | InChI=1S/C24H25F3N2O6S/c25-24(26,27)35-17-6-4-16(5-7-17)20(30)34-18-2-1-3-19(14-18)36(32,33)23(21(28)31)9-8-22(15-23)10-12-29-13-11-22/h1-7,14,29H,8-13,15H2,(H2,28,31) |
| InChIKey | BOMAXVKPVSWLEW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.53 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|