C23H24ClF3N2O6S — CID 118179865
3-[3-chloro-4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonyl-N-hydroxy-8-azaspiro[4.5]decane-3-carboxamide (PubChem CID 118179865) has the molecular formula C23H24ClF3N2O6S and a molecular weight of 548.97 g/mol. Its IUPAC name is 3-[3-chloro-4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonyl-N-hydroxy-8-azaspiro[4.5]decane-3-carboxamide.
| Compound Name | 3-[3-chloro-4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonyl-N-hydroxy-8-azaspiro[4.5]decane-3-carboxamide |
|---|---|
| PubChem CID | 118179865 |
| Molecular Formula | C23H24ClF3N2O6S |
| Molecular Weight | 548.97 g/mol |
| Exact Mass | 548.10 |
| IUPAC Name | 3-[3-chloro-4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonyl-N-hydroxy-8-azaspiro[4.5]decane-3-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)c2ccc(Oc3ccc(OC(F)(F)F)cc3)c(Cl)c2)CCC2(CCNCC2)C1 |
| InChI | InChI=1S/C23H24ClF3N2O6S/c24-18-13-17(5-6-19(18)34-15-1-3-16(4-2-15)35-23(25,26)27)36(32,33)22(20(30)29-31)8-7-21(14-22)9-11-28-12-10-21/h1-6,13,28,31H,7-12,14H2,(H,29,30) |
| InChIKey | MKCKIGOKGYMJOH-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.97 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|