C24H27ClN2O7S — CID 118179860
[2-chloro-4-[[3-(hydroxycarbamoyl)-8-azaspiro[4.5]decan-3-yl]sulfonyl]phenyl] 4-methoxybenzoate (PubChem CID 118179860) has the molecular formula C24H27ClN2O7S and a molecular weight of 523.01 g/mol. Its IUPAC name is [2-chloro-4-[[3-(hydroxycarbamoyl)-8-azaspiro[4.5]decan-3-yl]sulfonyl]phenyl] 4-methoxybenzoate.
| Compound Name | [2-chloro-4-[[3-(hydroxycarbamoyl)-8-azaspiro[4.5]decan-3-yl]sulfonyl]phenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 118179860 |
| Molecular Formula | C24H27ClN2O7S |
| Molecular Weight | 523.01 g/mol |
| Exact Mass | 522.12 |
| IUPAC Name | [2-chloro-4-[[3-(hydroxycarbamoyl)-8-azaspiro[4.5]decan-3-yl]sulfonyl]phenyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc(S(=O)(=O)C3(C(=O)NO)CCC4(CCNCC4)C3)cc2Cl)cc1 |
| InChI | InChI=1S/C24H27ClN2O7S/c1-33-17-4-2-16(3-5-17)21(28)34-20-7-6-18(14-19(20)25)35(31,32)24(22(29)27-30)9-8-23(15-24)10-12-26-13-11-23/h2-7,14,26,30H,8-13,15H2,1H3,(H,27,29) |
| InChIKey | TVYWKGIOFJEPQW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.01 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|