C24H26N2O7S — CID 126489884
4-[4-[(3-carbamoyl-8-azaspiro[4.5]decan-3-yl)sulfonyl]phenoxy]carbonylbenzoic acid (PubChem CID 126489884) has the molecular formula C24H26N2O7S and a molecular weight of 486.55 g/mol. Its IUPAC name is 4-[4-[(3-carbamoyl-8-azaspiro[4.5]decan-3-yl)sulfonyl]phenoxy]carbonylbenzoic acid.
| Compound Name | 4-[4-[(3-carbamoyl-8-azaspiro[4.5]decan-3-yl)sulfonyl]phenoxy]carbonylbenzoic acid |
|---|---|
| PubChem CID | 126489884 |
| Molecular Formula | C24H26N2O7S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 4-[4-[(3-carbamoyl-8-azaspiro[4.5]decan-3-yl)sulfonyl]phenoxy]carbonylbenzoic acid |
| SMILES | NC(=O)C1(S(=O)(=O)c2ccc(OC(=O)c3ccc(C(=O)O)cc3)cc2)CCC2(CCNCC2)C1 |
| InChI | InChI=1S/C24H26N2O7S/c25-22(30)24(10-9-23(15-24)11-13-26-14-12-23)34(31,32)19-7-5-18(6-8-19)33-21(29)17-3-1-16(2-4-17)20(27)28/h1-8,26H,9-15H2,(H2,25,30)(H,27,28) |
| InChIKey | ZWNGBZWWLGGEQN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 152.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|