C29H32N2O6S — CID 72948809
N-hydroxy-3-[4-(4-methoxyphenoxy)phenyl]sulfonyl-8-phenyl-8-azaspiro[4.5]decane-3-carboxamide (PubChem CID 72948809) has the molecular formula C29H32N2O6S and a molecular weight of 536.65 g/mol. Its IUPAC name is N-hydroxy-3-[4-(4-methoxyphenoxy)phenyl]sulfonyl-8-phenyl-8-azaspiro[4.5]decane-3-carboxamide.
| Compound Name | N-hydroxy-3-[4-(4-methoxyphenoxy)phenyl]sulfonyl-8-phenyl-8-azaspiro[4.5]decane-3-carboxamide |
|---|---|
| PubChem CID | 72948809 |
| Molecular Formula | C29H32N2O6S |
| Molecular Weight | 536.65 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | N-hydroxy-3-[4-(4-methoxyphenoxy)phenyl]sulfonyl-8-phenyl-8-azaspiro[4.5]decane-3-carboxamide |
| SMILES | COc1ccc(Oc2ccc(S(=O)(=O)C3(C(=O)NO)CCC4(CCN(c5ccccc5)CC4)C3)cc2)cc1 |
| InChI | InChI=1S/C29H32N2O6S/c1-36-23-7-9-24(10-8-23)37-25-11-13-26(14-12-25)38(34,35)29(27(32)30-33)16-15-28(21-29)17-19-31(20-18-28)22-5-3-2-4-6-22/h2-14,33H,15-21H2,1H3,(H,30,32) |
| InChIKey | KFTLIBRLYQXSHG-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.65 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|