C19H21NO8S2 — CID 22707846
N-hydroxy-4-[4-(4-methoxyphenoxy)phenyl]sulfonyl-1,1-dioxothiane-4-carboxamide (PubChem CID 22707846) has the molecular formula C19H21NO8S2 and a molecular weight of 455.51 g/mol. Its IUPAC name is N-hydroxy-4-[4-(4-methoxyphenoxy)phenyl]sulfonyl-1,1-dioxothiane-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-(4-methoxyphenoxy)phenyl]sulfonyl-1,1-dioxothiane-4-carboxamide |
|---|---|
| PubChem CID | 22707846 |
| Molecular Formula | C19H21NO8S2 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | N-hydroxy-4-[4-(4-methoxyphenoxy)phenyl]sulfonyl-1,1-dioxothiane-4-carboxamide |
| SMILES | COc1ccc(Oc2ccc(S(=O)(=O)C3(C(=O)NO)CCS(=O)(=O)CC3)cc2)cc1 |
| InChI | InChI=1S/C19H21NO8S2/c1-27-14-2-4-15(5-3-14)28-16-6-8-17(9-7-16)30(25,26)19(18(21)20-22)10-12-29(23,24)13-11-19/h2-9,22H,10-13H2,1H3,(H,20,21) |
| InChIKey | UZFRNPGCZDQEBS-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|