C23H29NO6S — CID 20620689
N-hydroxy-4-[4-[4-(4-methoxyphenyl)butyl]phenyl]sulfonyloxane-4-carboxamide (PubChem CID 20620689) has the molecular formula C23H29NO6S and a molecular weight of 447.55 g/mol. Its IUPAC name is N-hydroxy-4-[4-[4-(4-methoxyphenyl)butyl]phenyl]sulfonyloxane-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-[4-(4-methoxyphenyl)butyl]phenyl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 20620689 |
| Molecular Formula | C23H29NO6S |
| Molecular Weight | 447.55 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | N-hydroxy-4-[4-[4-(4-methoxyphenyl)butyl]phenyl]sulfonyloxane-4-carboxamide |
| SMILES | COc1ccc(CCCCc2ccc(S(=O)(=O)C3(C(=O)NO)CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C23H29NO6S/c1-29-20-10-6-18(7-11-20)4-2-3-5-19-8-12-21(13-9-19)31(27,28)23(22(25)24-26)14-16-30-17-15-23/h6-13,26H,2-5,14-17H2,1H3,(H,24,25) |
| InChIKey | CVCSUEIURPVINS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.55 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|