C22H27NO7S — CID 20620571
N-hydroxy-4-[4-[3-(4-methoxyphenyl)propoxy]phenyl]sulfonyloxane-4-carboxamide (PubChem CID 20620571) has the molecular formula C22H27NO7S and a molecular weight of 449.53 g/mol. Its IUPAC name is N-hydroxy-4-[4-[3-(4-methoxyphenyl)propoxy]phenyl]sulfonyloxane-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-[3-(4-methoxyphenyl)propoxy]phenyl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 20620571 |
| Molecular Formula | C22H27NO7S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | N-hydroxy-4-[4-[3-(4-methoxyphenyl)propoxy]phenyl]sulfonyloxane-4-carboxamide |
| SMILES | COc1ccc(CCCOc2ccc(S(=O)(=O)C3(C(=O)NO)CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C22H27NO7S/c1-28-18-6-4-17(5-7-18)3-2-14-30-19-8-10-20(11-9-19)31(26,27)22(21(24)23-25)12-15-29-16-13-22/h4-11,25H,2-3,12-16H2,1H3,(H,23,24) |
| InChIKey | AHNPNMKARJKRNE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|