C25H28N2O8S — CID 20620647
N-hydroxy-4-[4-[3-(7-methoxy-4-oxo-1H-quinolin-3-yl)propoxy]phenyl]sulfonyloxane-4-carboxamide (PubChem CID 20620647) has the molecular formula C25H28N2O8S and a molecular weight of 516.57 g/mol. Its IUPAC name is N-hydroxy-4-[4-[3-(7-methoxy-4-oxo-1H-quinolin-3-yl)propoxy]phenyl]sulfonyloxane-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-[3-(7-methoxy-4-oxo-1H-quinolin-3-yl)propoxy]phenyl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 20620647 |
| Molecular Formula | C25H28N2O8S |
| Molecular Weight | 516.57 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | N-hydroxy-4-[4-[3-(7-methoxy-4-oxo-1H-quinolin-3-yl)propoxy]phenyl]sulfonyloxane-4-carboxamide |
| SMILES | COc1ccc2c(=O)c(CCCOc3ccc(S(=O)(=O)C4(C(=O)NO)CCOCC4)cc3)c[nH]c2c1 |
| InChI | InChI=1S/C25H28N2O8S/c1-33-19-6-9-21-22(15-19)26-16-17(23(21)28)3-2-12-35-18-4-7-20(8-5-18)36(31,32)25(24(29)27-30)10-13-34-14-11-25/h4-9,15-16,30H,2-3,10-14H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | XBPAMHGKIQSVDI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 144.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.57 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|