C26H27NO7S — CID 10207036
N-hydroxy-4-[4-(4-naphthalen-1-yl-4-oxobutoxy)phenyl]sulfonyloxane-4-carboxamide (PubChem CID 10207036) has the molecular formula C26H27NO7S and a molecular weight of 497.57 g/mol. Its IUPAC name is N-hydroxy-4-[4-(4-naphthalen-1-yl-4-oxobutoxy)phenyl]sulfonyloxane-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-(4-naphthalen-1-yl-4-oxobutoxy)phenyl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 10207036 |
| Molecular Formula | C26H27NO7S |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | N-hydroxy-4-[4-(4-naphthalen-1-yl-4-oxobutoxy)phenyl]sulfonyloxane-4-carboxamide |
| SMILES | O=C(CCCOc1ccc(S(=O)(=O)C2(C(=O)NO)CCOCC2)cc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C26H27NO7S/c28-24(23-8-3-6-19-5-1-2-7-22(19)23)9-4-16-34-20-10-12-21(13-11-20)35(31,32)26(25(29)27-30)14-17-33-18-15-26/h1-3,5-8,10-13,30H,4,9,14-18H2,(H,27,29) |
| InChIKey | BZDMJVXGGLCTDW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|