C22H24N2O7S2 — CID 10206781
4-[4-[3-(1,3-benzoxazol-2-ylsulfanyl)propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide (PubChem CID 10206781) has the molecular formula C22H24N2O7S2 and a molecular weight of 492.58 g/mol. Its IUPAC name is 4-[4-[3-(1,3-benzoxazol-2-ylsulfanyl)propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide.
| Compound Name | 4-[4-[3-(1,3-benzoxazol-2-ylsulfanyl)propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
|---|---|
| PubChem CID | 10206781 |
| Molecular Formula | C22H24N2O7S2 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | 4-[4-[3-(1,3-benzoxazol-2-ylsulfanyl)propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)c2ccc(OCCCSc3nc4ccccc4o3)cc2)CCOCC1 |
| InChI | InChI=1S/C22H24N2O7S2/c25-20(24-26)22(10-13-29-14-11-22)33(27,28)17-8-6-16(7-9-17)30-12-3-15-32-21-23-18-4-1-2-5-19(18)31-21/h1-2,4-9,26H,3,10-15H2,(H,24,25) |
| InChIKey | RBKGOHBVIZTUTB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 127.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|