C22H25N3O7S — CID 20620382
4-[4-[2-[1,3-benzoxazol-2-yl(methyl)amino]ethoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide (PubChem CID 20620382) has the molecular formula C22H25N3O7S and a molecular weight of 475.52 g/mol. Its IUPAC name is 4-[4-[2-[1,3-benzoxazol-2-yl(methyl)amino]ethoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide.
| Compound Name | 4-[4-[2-[1,3-benzoxazol-2-yl(methyl)amino]ethoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
|---|---|
| PubChem CID | 20620382 |
| Molecular Formula | C22H25N3O7S |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | 4-[4-[2-[1,3-benzoxazol-2-yl(methyl)amino]ethoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
| SMILES | CN(CCOc1ccc(S(=O)(=O)C2(C(=O)NO)CCOCC2)cc1)c1nc2ccccc2o1 |
| InChI | InChI=1S/C22H25N3O7S/c1-25(21-23-18-4-2-3-5-19(18)32-21)12-15-31-16-6-8-17(9-7-16)33(28,29)22(20(26)24-27)10-13-30-14-11-22/h2-9,27H,10-15H2,1H3,(H,24,26) |
| InChIKey | SYRNQSRJTCXQQS-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 131.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|