C23H27NO8S — CID 10184126
N-hydroxy-4-[4-[4-(4-methoxyphenyl)-4-oxobutoxy]phenyl]sulfonyloxane-4-carboxamide (PubChem CID 10184126) has the molecular formula C23H27NO8S and a molecular weight of 477.54 g/mol. Its IUPAC name is N-hydroxy-4-[4-[4-(4-methoxyphenyl)-4-oxobutoxy]phenyl]sulfonyloxane-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-[4-(4-methoxyphenyl)-4-oxobutoxy]phenyl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 10184126 |
| Molecular Formula | C23H27NO8S |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | N-hydroxy-4-[4-[4-(4-methoxyphenyl)-4-oxobutoxy]phenyl]sulfonyloxane-4-carboxamide |
| SMILES | COc1ccc(C(=O)CCCOc2ccc(S(=O)(=O)C3(C(=O)NO)CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C23H27NO8S/c1-30-18-6-4-17(5-7-18)21(25)3-2-14-32-19-8-10-20(11-9-19)33(28,29)23(22(26)24-27)12-15-31-16-13-23/h4-11,27H,2-3,12-16H2,1H3,(H,24,26) |
| InChIKey | PLPIRJVZJFNLOO-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|