C23H27N3O8S — CID 20620808
N-hydroxy-4-[4-[3-[(4-methoxybenzoyl)amino]propanoylamino]phenyl]sulfonyloxane-4-carboxamide (PubChem CID 20620808) has the molecular formula C23H27N3O8S and a molecular weight of 505.55 g/mol. Its IUPAC name is N-hydroxy-4-[4-[3-[(4-methoxybenzoyl)amino]propanoylamino]phenyl]sulfonyloxane-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-[3-[(4-methoxybenzoyl)amino]propanoylamino]phenyl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 20620808 |
| Molecular Formula | C23H27N3O8S |
| Molecular Weight | 505.55 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | N-hydroxy-4-[4-[3-[(4-methoxybenzoyl)amino]propanoylamino]phenyl]sulfonyloxane-4-carboxamide |
| SMILES | COc1ccc(C(=O)NCCC(=O)Nc2ccc(S(=O)(=O)C3(C(=O)NO)CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C23H27N3O8S/c1-33-18-6-2-16(3-7-18)21(28)24-13-10-20(27)25-17-4-8-19(9-5-17)35(31,32)23(22(29)26-30)11-14-34-15-12-23/h2-9,30H,10-15H2,1H3,(H,24,28)(H,25,27)(H,26,29) |
| InChIKey | VVBIKPQEUKZLRW-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 160.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.55 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|