C20H26N4O7S2 — CID 20780943
4-amino-N-[3-[4-[4-(hydroxycarbamoyl)oxan-4-yl]sulfonylphenoxy]propyl]-2-methyl-1,3-thiazole-5-carboxamide (PubChem CID 20780943) has the molecular formula C20H26N4O7S2 and a molecular weight of 498.58 g/mol. Its IUPAC name is 4-amino-N-[3-[4-[4-(hydroxycarbamoyl)oxan-4-yl]sulfonylphenoxy]propyl]-2-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-N-[3-[4-[4-(hydroxycarbamoyl)oxan-4-yl]sulfonylphenoxy]propyl]-2-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 20780943 |
| Molecular Formula | C20H26N4O7S2 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | 4-amino-N-[3-[4-[4-(hydroxycarbamoyl)oxan-4-yl]sulfonylphenoxy]propyl]-2-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(N)c(C(=O)NCCCOc2ccc(S(=O)(=O)C3(C(=O)NO)CCOCC3)cc2)s1 |
| InChI | InChI=1S/C20H26N4O7S2/c1-13-23-17(21)16(32-13)18(25)22-9-2-10-31-14-3-5-15(6-4-14)33(28,29)20(19(26)24-27)7-11-30-12-8-20/h3-6,27H,2,7-12,21H2,1H3,(H,22,25)(H,24,26) |
| InChIKey | SRPGLLBNDIXUPP-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 169.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|