C23H25N3O7S — CID 20620754
4-[4-[3-[(4-cyanobenzoyl)amino]propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide (PubChem CID 20620754) has the molecular formula C23H25N3O7S and a molecular weight of 487.53 g/mol. Its IUPAC name is 4-[4-[3-[(4-cyanobenzoyl)amino]propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide.
| Compound Name | 4-[4-[3-[(4-cyanobenzoyl)amino]propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
|---|---|
| PubChem CID | 20620754 |
| Molecular Formula | C23H25N3O7S |
| Molecular Weight | 487.53 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | 4-[4-[3-[(4-cyanobenzoyl)amino]propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
| SMILES | N#Cc1ccc(C(=O)NCCCOc2ccc(S(=O)(=O)C3(C(=O)NO)CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C23H25N3O7S/c24-16-17-2-4-18(5-3-17)21(27)25-12-1-13-33-19-6-8-20(9-7-19)34(30,31)23(22(28)26-29)10-14-32-15-11-23/h2-9,29H,1,10-15H2,(H,25,27)(H,26,28) |
| InChIKey | BSVFFRJLDIDPKW-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 154.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.53 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|