C24H26N2O7S — CID 20620695
4-[4-[(Z)-4-cyano-4-(4-methoxyphenyl)but-3-enoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide (PubChem CID 20620695) has the molecular formula C24H26N2O7S and a molecular weight of 486.55 g/mol. Its IUPAC name is 4-[4-[(Z)-4-cyano-4-(4-methoxyphenyl)but-3-enoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide.
| Compound Name | 4-[4-[(Z)-4-cyano-4-(4-methoxyphenyl)but-3-enoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
|---|---|
| PubChem CID | 20620695 |
| Molecular Formula | C24H26N2O7S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 4-[4-[(Z)-4-cyano-4-(4-methoxyphenyl)but-3-enoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
| SMILES | COc1ccc(/C(C#N)=C/CCOc2ccc(S(=O)(=O)C3(C(=O)NO)CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C24H26N2O7S/c1-31-20-6-4-18(5-7-20)19(17-25)3-2-14-33-21-8-10-22(11-9-21)34(29,30)24(23(27)26-28)12-15-32-16-13-24/h3-11,28H,2,12-16H2,1H3,(H,26,27)/b19-3+ |
| InChIKey | OQCOVWQAYQLNAV-QBROUFQSSA-N |
| XLogP | 2.90 |
| TPSA | 134.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|