C16H24N2O8S2 — CID 20620677
N-hydroxy-4-[4-[3-(methylsulfamoyl)propoxy]phenyl]sulfonyloxane-4-carboxamide (PubChem CID 20620677) has the molecular formula C16H24N2O8S2 and a molecular weight of 436.51 g/mol. Its IUPAC name is N-hydroxy-4-[4-[3-(methylsulfamoyl)propoxy]phenyl]sulfonyloxane-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-[3-(methylsulfamoyl)propoxy]phenyl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 20620677 |
| Molecular Formula | C16H24N2O8S2 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | N-hydroxy-4-[4-[3-(methylsulfamoyl)propoxy]phenyl]sulfonyloxane-4-carboxamide |
| SMILES | CNS(=O)(=O)CCCOc1ccc(S(=O)(=O)C2(C(=O)NO)CCOCC2)cc1 |
| InChI | InChI=1S/C16H24N2O8S2/c1-17-27(21,22)12-2-9-26-13-3-5-14(6-4-13)28(23,24)16(15(19)18-20)7-10-25-11-8-16/h3-6,17,20H,2,7-12H2,1H3,(H,18,19) |
| InChIKey | FJHYURFAJJTPLQ-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 148.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|