C24H30N2O6S — CID 20620474
4-[4-[3-(3,4-dihydro-2H-quinolin-1-yl)propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide (PubChem CID 20620474) has the molecular formula C24H30N2O6S and a molecular weight of 474.58 g/mol. Its IUPAC name is 4-[4-[3-(3,4-dihydro-2H-quinolin-1-yl)propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide.
| Compound Name | 4-[4-[3-(3,4-dihydro-2H-quinolin-1-yl)propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
|---|---|
| PubChem CID | 20620474 |
| Molecular Formula | C24H30N2O6S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 4-[4-[3-(3,4-dihydro-2H-quinolin-1-yl)propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)c2ccc(OCCCN3CCCc4ccccc43)cc2)CCOCC1 |
| InChI | InChI=1S/C24H30N2O6S/c27-23(25-28)24(12-17-31-18-13-24)33(29,30)21-10-8-20(9-11-21)32-16-4-15-26-14-3-6-19-5-1-2-7-22(19)26/h1-2,5,7-11,28H,3-4,6,12-18H2,(H,25,27) |
| InChIKey | YEIIXRFGZNXZSD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|