C24H27N3O8S — CID 20620403
4-[4-[3-(2,5-dioxo-4-phenylimidazolidin-1-yl)propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide (PubChem CID 20620403) has the molecular formula C24H27N3O8S and a molecular weight of 517.56 g/mol. Its IUPAC name is 4-[4-[3-(2,5-dioxo-4-phenylimidazolidin-1-yl)propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide.
| Compound Name | 4-[4-[3-(2,5-dioxo-4-phenylimidazolidin-1-yl)propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
|---|---|
| PubChem CID | 20620403 |
| Molecular Formula | C24H27N3O8S |
| Molecular Weight | 517.56 g/mol |
| Exact Mass | 517.15 |
| IUPAC Name | 4-[4-[3-(2,5-dioxo-4-phenylimidazolidin-1-yl)propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
| SMILES | O=C1NC(c2ccccc2)C(=O)N1CCCOc1ccc(S(=O)(=O)C2(C(=O)NO)CCOCC2)cc1 |
| InChI | InChI=1S/C24H27N3O8S/c28-21-20(17-5-2-1-3-6-17)25-23(30)27(21)13-4-14-35-18-7-9-19(10-8-18)36(32,33)24(22(29)26-31)11-15-34-16-12-24/h1-3,5-10,20,31H,4,11-16H2,(H,25,30)(H,26,29) |
| InChIKey | BHJVCHJAJDXLIF-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 151.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.56 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|