C24H28FN3O7S — CID 20620482
4-[4-[3-[3-(4-fluorophenyl)-2-oxoimidazolidin-1-yl]propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide (PubChem CID 20620482) has the molecular formula C24H28FN3O7S and a molecular weight of 521.57 g/mol. Its IUPAC name is 4-[4-[3-[3-(4-fluorophenyl)-2-oxoimidazolidin-1-yl]propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide.
| Compound Name | 4-[4-[3-[3-(4-fluorophenyl)-2-oxoimidazolidin-1-yl]propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
|---|---|
| PubChem CID | 20620482 |
| Molecular Formula | C24H28FN3O7S |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | 4-[4-[3-[3-(4-fluorophenyl)-2-oxoimidazolidin-1-yl]propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
| SMILES | O=C1N(CCCOc2ccc(S(=O)(=O)C3(C(=O)NO)CCOCC3)cc2)CCN1c1ccc(F)cc1 |
| InChI | InChI=1S/C24H28FN3O7S/c25-18-2-4-19(5-3-18)28-14-13-27(23(28)30)12-1-15-35-20-6-8-21(9-7-20)36(32,33)24(22(29)26-31)10-16-34-17-11-24/h2-9,31H,1,10-17H2,(H,26,29) |
| InChIKey | ISGDNONUVMLTHR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|