C28H34F3N3O8S — CID 142895744
N-hydroxy-4-[4-[(4R)-4-methyl-5-[2-oxo-3-[4-(trifluoromethoxy)phenyl]imidazolidin-1-yl]pentoxy]phenyl]sulfonyloxane-4-carboxamide (PubChem CID 142895744) has the molecular formula C28H34F3N3O8S and a molecular weight of 629.65 g/mol. Its IUPAC name is N-hydroxy-4-[4-[(4R)-4-methyl-5-[2-oxo-3-[4-(trifluoromethoxy)phenyl]imidazolidin-1-yl]pentoxy]phenyl]sulfonyloxane-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-[(4R)-4-methyl-5-[2-oxo-3-[4-(trifluoromethoxy)phenyl]imidazolidin-1-yl]pentoxy]phenyl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 142895744 |
| Molecular Formula | C28H34F3N3O8S |
| Molecular Weight | 629.65 g/mol |
| Exact Mass | 629.20 |
| IUPAC Name | N-hydroxy-4-[4-[(4R)-4-methyl-5-[2-oxo-3-[4-(trifluoromethoxy)phenyl]imidazolidin-1-yl]pentoxy]phenyl]sulfonyloxane-4-carboxamide |
| SMILES | C[C@H](CCCOc1ccc(S(=O)(=O)C2(C(=O)NO)CCOCC2)cc1)CN1CCN(c2ccc(OC(F)(F)F)cc2)C1=O |
| InChI | InChI=1S/C28H34F3N3O8S/c1-20(19-33-14-15-34(26(33)36)21-4-6-23(7-5-21)42-28(29,30)31)3-2-16-41-22-8-10-24(11-9-22)43(38,39)27(25(35)32-37)12-17-40-18-13-27/h4-11,20,37H,2-3,12-19H2,1H3,(H,32,35)/t20-/m1/s1 |
| InChIKey | AKPAXYIOKAHISP-HXUWFJFHSA-N |
| XLogP | 4.15 |
| TPSA | 134.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.65 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|