C24H24F3N3O8S — CID 20620619
N-hydroxy-4-[4-[3-[5-[4-(trifluoromethoxy)phenyl]-1,3,4-oxadiazol-2-yl]propoxy]phenyl]sulfonyloxane-4-carboxamide (PubChem CID 20620619) has the molecular formula C24H24F3N3O8S and a molecular weight of 571.53 g/mol. Its IUPAC name is N-hydroxy-4-[4-[3-[5-[4-(trifluoromethoxy)phenyl]-1,3,4-oxadiazol-2-yl]propoxy]phenyl]sulfonyloxane-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-[3-[5-[4-(trifluoromethoxy)phenyl]-1,3,4-oxadiazol-2-yl]propoxy]phenyl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 20620619 |
| Molecular Formula | C24H24F3N3O8S |
| Molecular Weight | 571.53 g/mol |
| Exact Mass | 571.12 |
| IUPAC Name | N-hydroxy-4-[4-[3-[5-[4-(trifluoromethoxy)phenyl]-1,3,4-oxadiazol-2-yl]propoxy]phenyl]sulfonyloxane-4-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)c2ccc(OCCCc3nnc(-c4ccc(OC(F)(F)F)cc4)o3)cc2)CCOCC1 |
| InChI | InChI=1S/C24H24F3N3O8S/c25-24(26,27)38-18-5-3-16(4-6-18)21-29-28-20(37-21)2-1-13-36-17-7-9-19(10-8-17)39(33,34)23(22(31)30-32)11-14-35-15-12-23/h3-10,32H,1-2,11-15H2,(H,30,31) |
| InChIKey | BDSHYXPXSLIEPQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 150.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.53 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|