C22H24N4O7S — CID 20620454
N-hydroxy-4-[4-[3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propoxy]phenyl]sulfonyloxane-4-carboxamide (PubChem CID 20620454) has the molecular formula C22H24N4O7S and a molecular weight of 488.52 g/mol. Its IUPAC name is N-hydroxy-4-[4-[3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propoxy]phenyl]sulfonyloxane-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-[3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propoxy]phenyl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 20620454 |
| Molecular Formula | C22H24N4O7S |
| Molecular Weight | 488.52 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | N-hydroxy-4-[4-[3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propoxy]phenyl]sulfonyloxane-4-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)c2ccc(OCCCc3nc(-c4cccnc4)no3)cc2)CCOCC1 |
| InChI | InChI=1S/C22H24N4O7S/c27-21(25-28)22(9-13-31-14-10-22)34(29,30)18-7-5-17(6-8-18)32-12-2-4-19-24-20(26-33-19)16-3-1-11-23-15-16/h1,3,5-8,11,15,28H,2,4,9-10,12-14H2,(H,25,27) |
| InChIKey | RPAWJOTTXLZQDA-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 153.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.52 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|