C30H33ClN4O7S — CID 158898130
N-hydroxy-4-[4-[3-(3-naphthalen-1-yl-1,2,4-oxadiazol-5-yl)propoxy]phenyl]sulfonyl-1-(3-oxopropyl)piperidine-4-carboxamide;hydrochloride (PubChem CID 158898130) has the molecular formula C30H33ClN4O7S and a molecular weight of 629.14 g/mol. Its IUPAC name is N-hydroxy-4-[4-[3-(3-naphthalen-1-yl-1,2,4-oxadiazol-5-yl)propoxy]phenyl]sulfonyl-1-(3-oxopropyl)piperidine-4-carboxamide;hydrochloride.
| Compound Name | N-hydroxy-4-[4-[3-(3-naphthalen-1-yl-1,2,4-oxadiazol-5-yl)propoxy]phenyl]sulfonyl-1-(3-oxopropyl)piperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 158898130 |
| Molecular Formula | C30H33ClN4O7S |
| Molecular Weight | 629.14 g/mol |
| Exact Mass | 628.18 |
| IUPAC Name | N-hydroxy-4-[4-[3-(3-naphthalen-1-yl-1,2,4-oxadiazol-5-yl)propoxy]phenyl]sulfonyl-1-(3-oxopropyl)piperidine-4-carboxamide;hydrochloride |
| SMILES | Cl.O=CCCN1CCC(C(=O)NO)(S(=O)(=O)c2ccc(OCCCc3nc(-c4cccc5ccccc45)no3)cc2)CC1 |
| InChI | InChI=1S/C30H32N4O7S.ClH/c35-20-5-17-34-18-15-30(16-19-34,29(36)32-37)42(38,39)24-13-11-23(12-14-24)40-21-4-10-27-31-28(33-41-27)26-9-3-7-22-6-1-2-8-25(22)26;/h1-3,6-9,11-14,20,37H,4-5,10,15-19,21H2,(H,32,36);1H |
| InChIKey | OMVALTROVKWRFK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 151.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.14 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|