C26H35ClN6O7S — CID 169425374
N-hydroxy-1-(2-methoxyethyl)-4-[4-[3-[5-(2-methoxyphenyl)tetrazol-2-yl]propoxy]phenyl]sulfonylpiperidine-4-carboxamide;hydrochloride (PubChem CID 169425374) has the molecular formula C26H35ClN6O7S and a molecular weight of 611.12 g/mol. Its IUPAC name is N-hydroxy-1-(2-methoxyethyl)-4-[4-[3-[5-(2-methoxyphenyl)tetrazol-2-yl]propoxy]phenyl]sulfonylpiperidine-4-carboxamide;hydrochloride.
| Compound Name | N-hydroxy-1-(2-methoxyethyl)-4-[4-[3-[5-(2-methoxyphenyl)tetrazol-2-yl]propoxy]phenyl]sulfonylpiperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 169425374 |
| Molecular Formula | C26H35ClN6O7S |
| Molecular Weight | 611.12 g/mol |
| Exact Mass | 610.20 |
| IUPAC Name | N-hydroxy-1-(2-methoxyethyl)-4-[4-[3-[5-(2-methoxyphenyl)tetrazol-2-yl]propoxy]phenyl]sulfonylpiperidine-4-carboxamide;hydrochloride |
| SMILES | COCCN1CCC(C(=O)NO)(S(=O)(=O)c2ccc(OCCCn3nnc(-c4ccccc4OC)n3)cc2)CC1.Cl |
| InChI | InChI=1S/C26H34N6O7S.ClH/c1-37-19-17-31-15-12-26(13-16-31,25(33)29-34)40(35,36)21-10-8-20(9-11-21)39-18-5-14-32-28-24(27-30-32)22-6-3-4-7-23(22)38-2;/h3-4,6-11,34H,5,12-19H2,1-2H3,(H,29,33);1H |
| InChIKey | NCQOCKRBVCURFJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 158.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.12 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|