C23H37FN4O6S — CID 21068800
4-[4-[4-(4-fluorobutoxy)phenyl]piperazin-1-yl]sulfonyl-N-hydroxy-1-(2-methoxyethyl)piperidine-4-carboxamide (PubChem CID 21068800) has the molecular formula C23H37FN4O6S and a molecular weight of 516.64 g/mol. Its IUPAC name is 4-[4-[4-(4-fluorobutoxy)phenyl]piperazin-1-yl]sulfonyl-N-hydroxy-1-(2-methoxyethyl)piperidine-4-carboxamide.
| Compound Name | 4-[4-[4-(4-fluorobutoxy)phenyl]piperazin-1-yl]sulfonyl-N-hydroxy-1-(2-methoxyethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 21068800 |
| Molecular Formula | C23H37FN4O6S |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | 4-[4-[4-(4-fluorobutoxy)phenyl]piperazin-1-yl]sulfonyl-N-hydroxy-1-(2-methoxyethyl)piperidine-4-carboxamide |
| SMILES | COCCN1CCC(C(=O)NO)(S(=O)(=O)N2CCN(c3ccc(OCCCCF)cc3)CC2)CC1 |
| InChI | InChI=1S/C23H37FN4O6S/c1-33-19-17-26-11-8-23(9-12-26,22(29)25-30)35(31,32)28-15-13-27(14-16-28)20-4-6-21(7-5-20)34-18-3-2-10-24/h4-7,30H,2-3,8-19H2,1H3,(H,25,29) |
| InChIKey | QDUNIMSGPGVSNT-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|