C24H38Cl2N6O5S — CID 162332109
4-[4-(4-butoxyphenyl)piperazin-1-yl]sulfonyl-N-hydroxy-1-(1H-imidazol-2-ylmethyl)piperidine-4-carboxamide;dihydrochloride (PubChem CID 162332109) has the molecular formula C24H38Cl2N6O5S and a molecular weight of 593.58 g/mol. Its IUPAC name is 4-[4-(4-butoxyphenyl)piperazin-1-yl]sulfonyl-N-hydroxy-1-(1H-imidazol-2-ylmethyl)piperidine-4-carboxamide;dihydrochloride.
| Compound Name | 4-[4-(4-butoxyphenyl)piperazin-1-yl]sulfonyl-N-hydroxy-1-(1H-imidazol-2-ylmethyl)piperidine-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 162332109 |
| Molecular Formula | C24H38Cl2N6O5S |
| Molecular Weight | 593.58 g/mol |
| Exact Mass | 592.20 |
| IUPAC Name | 4-[4-(4-butoxyphenyl)piperazin-1-yl]sulfonyl-N-hydroxy-1-(1H-imidazol-2-ylmethyl)piperidine-4-carboxamide;dihydrochloride |
| SMILES | CCCCOc1ccc(N2CCN(S(=O)(=O)C3(C(=O)NO)CCN(Cc4ncc[nH]4)CC3)CC2)cc1.Cl.Cl |
| InChI | InChI=1S/C24H36N6O5S.2ClH/c1-2-3-18-35-21-6-4-20(5-7-21)29-14-16-30(17-15-29)36(33,34)24(23(31)27-32)8-12-28(13-9-24)19-22-25-10-11-26-22;;/h4-7,10-11,32H,2-3,8-9,12-19H2,1H3,(H,25,26)(H,27,31);2*1H |
| InChIKey | PBXLFNFEWUHBKY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 131.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.58 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|