C25H35ClN4O6S2 — CID 162326307
4-[4-(4-butoxyphenyl)piperazin-1-yl]sulfonyl-N-hydroxy-1-(thiophene-2-carbonyl)piperidine-4-carboxamide;hydrochloride (PubChem CID 162326307) has the molecular formula C25H35ClN4O6S2 and a molecular weight of 587.16 g/mol. Its IUPAC name is 4-[4-(4-butoxyphenyl)piperazin-1-yl]sulfonyl-N-hydroxy-1-(thiophene-2-carbonyl)piperidine-4-carboxamide;hydrochloride.
| Compound Name | 4-[4-(4-butoxyphenyl)piperazin-1-yl]sulfonyl-N-hydroxy-1-(thiophene-2-carbonyl)piperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 162326307 |
| Molecular Formula | C25H35ClN4O6S2 |
| Molecular Weight | 587.16 g/mol |
| Exact Mass | 586.17 |
| IUPAC Name | 4-[4-(4-butoxyphenyl)piperazin-1-yl]sulfonyl-N-hydroxy-1-(thiophene-2-carbonyl)piperidine-4-carboxamide;hydrochloride |
| SMILES | CCCCOc1ccc(N2CCN(S(=O)(=O)C3(C(=O)NO)CCN(C(=O)c4cccs4)CC3)CC2)cc1.Cl |
| InChI | InChI=1S/C25H34N4O6S2.ClH/c1-2-3-18-35-21-8-6-20(7-9-21)27-14-16-29(17-15-27)37(33,34)25(24(31)26-32)10-12-28(13-11-25)23(30)22-5-4-19-36-22;/h4-9,19,32H,2-3,10-18H2,1H3,(H,26,31);1H |
| InChIKey | JJICETLLLQJDHH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.16 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|