C28H41ClN4O4S — CID 162328110
N-hydroxy-1-(4-methylphenyl)-4-[4-(4-pentylphenyl)piperazin-1-yl]sulfonylpiperidine-4-carboxamide;hydrochloride (PubChem CID 162328110) has the molecular formula C28H41ClN4O4S and a molecular weight of 565.18 g/mol. Its IUPAC name is N-hydroxy-1-(4-methylphenyl)-4-[4-(4-pentylphenyl)piperazin-1-yl]sulfonylpiperidine-4-carboxamide;hydrochloride.
| Compound Name | N-hydroxy-1-(4-methylphenyl)-4-[4-(4-pentylphenyl)piperazin-1-yl]sulfonylpiperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 162328110 |
| Molecular Formula | C28H41ClN4O4S |
| Molecular Weight | 565.18 g/mol |
| Exact Mass | 564.25 |
| IUPAC Name | N-hydroxy-1-(4-methylphenyl)-4-[4-(4-pentylphenyl)piperazin-1-yl]sulfonylpiperidine-4-carboxamide;hydrochloride |
| SMILES | CCCCCc1ccc(N2CCN(S(=O)(=O)C3(C(=O)NO)CCN(c4ccc(C)cc4)CC3)CC2)cc1.Cl |
| InChI | InChI=1S/C28H40N4O4S.ClH/c1-3-4-5-6-24-9-13-26(14-10-24)31-19-21-32(22-20-31)37(35,36)28(27(33)29-34)15-17-30(18-16-28)25-11-7-23(2)8-12-25;/h7-14,34H,3-6,15-22H2,1-2H3,(H,29,33);1H |
| InChIKey | NMAOQQRVODQCTL-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.18 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|