C20H28ClF5N4O4S — CID 159345731
N-hydroxy-4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]piperazin-1-yl]sulfonylpiperidine-4-carboxamide;hydrochloride (PubChem CID 159345731) has the molecular formula C20H28ClF5N4O4S and a molecular weight of 550.98 g/mol. Its IUPAC name is N-hydroxy-4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]piperazin-1-yl]sulfonylpiperidine-4-carboxamide;hydrochloride.
| Compound Name | N-hydroxy-4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]piperazin-1-yl]sulfonylpiperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 159345731 |
| Molecular Formula | C20H28ClF5N4O4S |
| Molecular Weight | 550.98 g/mol |
| Exact Mass | 550.14 |
| IUPAC Name | N-hydroxy-4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]piperazin-1-yl]sulfonylpiperidine-4-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NO)C1(S(=O)(=O)N2CCN(c3ccc(CCC(F)(F)C(F)(F)F)cc3)CC2)CCNCC1 |
| InChI | InChI=1S/C20H27F5N4O4S.ClH/c21-19(22,20(23,24)25)6-5-15-1-3-16(4-2-15)28-11-13-29(14-12-28)34(32,33)18(17(30)27-31)7-9-26-10-8-18;/h1-4,26,31H,5-14H2,(H,27,30);1H |
| InChIKey | ARZDWGPARHBERC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.98 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|