C19H26ClF5N4O5S — CID 161472394
N-hydroxy-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrimidin-2-yl]piperidin-1-yl]sulfonyloxane-4-carboxamide;hydrochloride (PubChem CID 161472394) has the molecular formula C19H26ClF5N4O5S and a molecular weight of 552.95 g/mol. Its IUPAC name is N-hydroxy-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrimidin-2-yl]piperidin-1-yl]sulfonyloxane-4-carboxamide;hydrochloride.
| Compound Name | N-hydroxy-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrimidin-2-yl]piperidin-1-yl]sulfonyloxane-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 161472394 |
| Molecular Formula | C19H26ClF5N4O5S |
| Molecular Weight | 552.95 g/mol |
| Exact Mass | 552.12 |
| IUPAC Name | N-hydroxy-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrimidin-2-yl]piperidin-1-yl]sulfonyloxane-4-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NO)C1(S(=O)(=O)N2CCC(c3ncc(CCC(F)(F)C(F)(F)F)cn3)CC2)CCOCC1 |
| InChI | InChI=1S/C19H25F5N4O5S.ClH/c20-18(21,19(22,23)24)4-1-13-11-25-15(26-12-13)14-2-7-28(8-3-14)34(31,32)17(16(29)27-30)5-9-33-10-6-17;/h11-12,14,30H,1-10H2,(H,27,29);1H |
| InChIKey | JMHTYHJXAWOBJC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 121.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.95 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|