C20H25F5N2O6S — CID 21068755
N-hydroxy-4-[4-[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]piperidin-1-yl]sulfonyloxane-4-carboxamide (PubChem CID 21068755) has the molecular formula C20H25F5N2O6S and a molecular weight of 516.49 g/mol. Its IUPAC name is N-hydroxy-4-[4-[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]piperidin-1-yl]sulfonyloxane-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]piperidin-1-yl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 21068755 |
| Molecular Formula | C20H25F5N2O6S |
| Molecular Weight | 516.49 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | N-hydroxy-4-[4-[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]piperidin-1-yl]sulfonyloxane-4-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)N2CCC(c3ccc(OCC(F)(F)C(F)(F)F)cc3)CC2)CCOCC1 |
| InChI | InChI=1S/C20H25F5N2O6S/c21-19(22,20(23,24)25)13-33-16-3-1-14(2-4-16)15-5-9-27(10-6-15)34(30,31)18(17(28)26-29)7-11-32-12-8-18/h1-4,15,29H,5-13H2,(H,26,28) |
| InChIKey | DWNMKIYWPAGDDJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|