C22H34F3N3O6S — CID 143045285
ethane;N-hydroxy-4-[4-[4-(4,4,4-trifluorobutoxy)phenyl]piperazin-1-yl]sulfonyloxane-4-carboxamide (PubChem CID 143045285) has the molecular formula C22H34F3N3O6S and a molecular weight of 525.59 g/mol. Its IUPAC name is ethane;N-hydroxy-4-[4-[4-(4,4,4-trifluorobutoxy)phenyl]piperazin-1-yl]sulfonyloxane-4-carboxamide.
| Compound Name | ethane;N-hydroxy-4-[4-[4-(4,4,4-trifluorobutoxy)phenyl]piperazin-1-yl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 143045285 |
| Molecular Formula | C22H34F3N3O6S |
| Molecular Weight | 525.59 g/mol |
| Exact Mass | 525.21 |
| IUPAC Name | ethane;N-hydroxy-4-[4-[4-(4,4,4-trifluorobutoxy)phenyl]piperazin-1-yl]sulfonyloxane-4-carboxamide |
| SMILES | CC.O=C(NO)C1(S(=O)(=O)N2CCN(c3ccc(OCCCC(F)(F)F)cc3)CC2)CCOCC1 |
| InChI | InChI=1S/C20H28F3N3O6S.C2H6/c21-20(22,23)6-1-13-32-17-4-2-16(3-5-17)25-9-11-26(12-10-25)33(29,30)19(18(27)24-28)7-14-31-15-8-19;1-2/h2-5,28H,1,6-15H2,(H,24,27);1-2H3 |
| InChIKey | PSBBPHXCUKDMLO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.59 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|